C21H27ClF3N3OS — CID 162717785
(6R)-1-[3-[methyl(oxan-4-yl)amino]propyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione;hydrochloride (PubChem CID 162717785) has the molecular formula C21H27ClF3N3OS and a molecular weight of 461.98 g/mol. Its IUPAC name is (6R)-1-[3-[methyl(oxan-4-yl)amino]propyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione;hydrochloride.
| Compound Name | (6R)-1-[3-[methyl(oxan-4-yl)amino]propyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione;hydrochloride |
|---|---|
| PubChem CID | 162717785 |
| Molecular Formula | C21H27ClF3N3OS |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | (6R)-1-[3-[methyl(oxan-4-yl)amino]propyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione;hydrochloride |
| SMILES | CN(CCCc1[nH]c(=S)n2c1C[C@H](c1c(F)ccc(F)c1F)C2)C1CCOCC1.Cl |
| InChI | InChI=1S/C21H26F3N3OS.ClH/c1-26(14-6-9-28-10-7-14)8-2-3-17-18-11-13(12-27(18)21(29)25-17)19-15(22)4-5-16(23)20(19)24;/h4-5,13-14H,2-3,6-12H2,1H3,(H,25,29);1H/t13-;/m0./s1 |
| InChIKey | ZQTNNHLNEFDIOT-ZOWNYOTGSA-N |
| XLogP | 4.77 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|