C19H20F3N3O2S — CID 162446447
2-[(3R)-oxan-3-yl]-2-[(6R)-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide (PubChem CID 162446447) has the molecular formula C19H20F3N3O2S and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-[(3R)-oxan-3-yl]-2-[(6R)-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide.
| Compound Name | 2-[(3R)-oxan-3-yl]-2-[(6R)-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 162446447 |
| Molecular Formula | C19H20F3N3O2S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[(3R)-oxan-3-yl]-2-[(6R)-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide |
| SMILES | NC(=O)C(c1[nH]c(=S)n2c1C[C@H](c1c(F)ccc(F)c1F)C2)[C@H]1CCCOC1 |
| InChI | InChI=1S/C19H20F3N3O2S/c20-11-3-4-12(21)16(22)14(11)10-6-13-17(24-19(28)25(13)7-10)15(18(23)26)9-2-1-5-27-8-9/h3-4,9-10,15H,1-2,5-8H2,(H2,23,26)(H,24,28)/t9-,10-,15?/m0/s1 |
| InChIKey | BIKHNLXKRODYPP-WUAMPTBBSA-N |
| XLogP | 3.30 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|