C21H24Cl2F4N4OS — CID 154638362
2-[(6S)-6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-[2-(4,4-difluoropiperidin-1-yl)ethyl]acetamide;hydrochloride (PubChem CID 154638362) has the molecular formula C21H24Cl2F4N4OS and a molecular weight of 527.42 g/mol. Its IUPAC name is 2-[(6S)-6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-[2-(4,4-difluoropiperidin-1-yl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-[(6S)-6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-[2-(4,4-difluoropiperidin-1-yl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 154638362 |
| Molecular Formula | C21H24Cl2F4N4OS |
| Molecular Weight | 527.42 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 2-[(6S)-6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-[2-(4,4-difluoropiperidin-1-yl)ethyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(Cc1[nH]c(=S)n2c1C[C@@H](c1c(F)ccc(Cl)c1F)C2)NCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C21H23ClF4N4OS.ClH/c22-13-1-2-14(23)18(19(13)24)12-9-16-15(28-20(32)30(16)11-12)10-17(31)27-5-8-29-6-3-21(25,26)4-7-29;/h1-2,12H,3-11H2,(H,27,31)(H,28,32);1H/t12-;/m1./s1 |
| InChIKey | AMMFAIMAIWHUCI-UTONKHPSSA-N |
| XLogP | 4.63 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|