C16H15F4N3OS — CID 142603146
N,N-dimethyl-2-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide (PubChem CID 142603146) has the molecular formula C16H15F4N3OS and a molecular weight of 373.38 g/mol. Its IUPAC name is N,N-dimethyl-2-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 142603146 |
| Molecular Formula | C16H15F4N3OS |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N,N-dimethyl-2-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide |
| SMILES | CN(C)C(=O)Cc1[nH]c(=S)n2c1C[C@H](c1c(F)c(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C16H15F4N3OS/c1-22(2)12(24)5-10-11-3-7(6-23(11)16(25)21-10)13-14(19)8(17)4-9(18)15(13)20/h4,7H,3,5-6H2,1-2H3,(H,21,25)/t7-/m0/s1 |
| InChIKey | IWAXJNKGRSQNHG-ZETCQYMHSA-N |
| XLogP | 3.07 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|