C18H15F3N4OS — CID 170158604
1-imidazol-1-yl-3-[3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]propan-1-one (PubChem CID 170158604) has the molecular formula C18H15F3N4OS and a molecular weight of 392.41 g/mol. Its IUPAC name is 1-imidazol-1-yl-3-[3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]propan-1-one.
| Compound Name | 1-imidazol-1-yl-3-[3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 170158604 |
| Molecular Formula | C18H15F3N4OS |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 1-imidazol-1-yl-3-[3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]propan-1-one |
| SMILES | O=C(CCc1[nH]c(=S)n2c1CC(c1c(F)ccc(F)c1F)C2)n1ccnc1 |
| InChI | InChI=1S/C18H15F3N4OS/c19-11-1-2-12(20)17(21)16(11)10-7-14-13(23-18(27)25(14)8-10)3-4-15(26)24-6-5-22-9-24/h1-2,5-6,9-10H,3-4,7-8H2,(H,23,27) |
| InChIKey | XKDSDCCANYXAOP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|