C19H16ClF2N3S — CID 154638365
(6S)-6-(3-chloro-2,6-difluorophenyl)-1-(2-pyridin-3-ylethyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 154638365) has the molecular formula C19H16ClF2N3S and a molecular weight of 391.87 g/mol. Its IUPAC name is (6S)-6-(3-chloro-2,6-difluorophenyl)-1-(2-pyridin-3-ylethyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6S)-6-(3-chloro-2,6-difluorophenyl)-1-(2-pyridin-3-ylethyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 154638365 |
| Molecular Formula | C19H16ClF2N3S |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | (6S)-6-(3-chloro-2,6-difluorophenyl)-1-(2-pyridin-3-ylethyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Fc1ccc(Cl)c(F)c1[C@@H]1Cc2c(CCc3cccnc3)[nH]c(=S)n2C1 |
| InChI | InChI=1S/C19H16ClF2N3S/c20-13-4-5-14(21)17(18(13)22)12-8-16-15(24-19(26)25(16)10-12)6-3-11-2-1-7-23-9-11/h1-2,4-5,7,9,12H,3,6,8,10H2,(H,24,26)/t12-/m1/s1 |
| InChIKey | WUVLJUFYEDXPIW-GFCCVEGCSA-N |
| XLogP | 5.00 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|