C11H13N3S — CID 81334784
5-methyl-3-(2-pyridin-3-ylethyl)-1H-imidazole-2-thione (PubChem CID 81334784) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 5-methyl-3-(2-pyridin-3-ylethyl)-1H-imidazole-2-thione.
| Compound Name | 5-methyl-3-(2-pyridin-3-ylethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81334784 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-methyl-3-(2-pyridin-3-ylethyl)-1H-imidazole-2-thione |
| SMILES | Cc1cn(CCc2cccnc2)c(=S)[nH]1 |
| InChI | InChI=1S/C11H13N3S/c1-9-8-14(11(15)13-9)6-4-10-3-2-5-12-7-10/h2-3,5,7-8H,4,6H2,1H3,(H,13,15) |
| InChIKey | FKFZTMKWAGJZDF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|