C17H15N3OS — CID 18470481
5-benzyl-1-(pyridin-3-ylmethyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 18470481) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 5-benzyl-1-(pyridin-3-ylmethyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-benzyl-1-(pyridin-3-ylmethyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 18470481 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-benzyl-1-(pyridin-3-ylmethyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(Cc2cccnc2)cc1Cc1ccccc1 |
| InChI | InChI=1S/C17H15N3OS/c21-16-15(9-13-5-2-1-3-6-13)12-20(17(22)19-16)11-14-7-4-8-18-10-14/h1-8,10,12H,9,11H2,(H,19,21,22) |
| InChIKey | VRWKFDPCNVWKLG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|