C16H14F4N2O2S — CID 139293299
ethyl 2-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetate (PubChem CID 139293299) has the molecular formula C16H14F4N2O2S and a molecular weight of 374.36 g/mol. Its IUPAC name is ethyl 2-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetate.
| Compound Name | ethyl 2-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetate |
|---|---|
| PubChem CID | 139293299 |
| Molecular Formula | C16H14F4N2O2S |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | ethyl 2-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetate |
| SMILES | CCOC(=O)Cc1[nH]c(=S)n2c1C[C@H](c1c(F)c(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C16H14F4N2O2S/c1-2-24-12(23)5-10-11-3-7(6-22(11)16(25)21-10)13-14(19)8(17)4-9(18)15(13)20/h4,7H,2-3,5-6H2,1H3,(H,21,25)/t7-/m0/s1 |
| InChIKey | QJLRVADYGGBHDW-ZETCQYMHSA-N |
| XLogP | 3.55 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|