C19H20BrF2N3O2S — CID 139293550
2-[(6S)-6-(3-bromo-2,6-difluorophenyl)-2-methyl-3-sulfanylidene-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-N-[(3S)-oxolan-3-yl]acetamide (PubChem CID 139293550) has the molecular formula C19H20BrF2N3O2S and a molecular weight of 472.36 g/mol. Its IUPAC name is 2-[(6S)-6-(3-bromo-2,6-difluorophenyl)-2-methyl-3-sulfanylidene-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-N-[(3S)-oxolan-3-yl]acetamide.
| Compound Name | 2-[(6S)-6-(3-bromo-2,6-difluorophenyl)-2-methyl-3-sulfanylidene-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-N-[(3S)-oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 139293550 |
| Molecular Formula | C19H20BrF2N3O2S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 2-[(6S)-6-(3-bromo-2,6-difluorophenyl)-2-methyl-3-sulfanylidene-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-N-[(3S)-oxolan-3-yl]acetamide |
| SMILES | Cn1c(CC(=O)N[C@H]2CCOC2)c2n(c1=S)C[C@H](c1c(F)ccc(Br)c1F)C2 |
| InChI | InChI=1S/C19H20BrF2N3O2S/c1-24-14(7-16(26)23-11-4-5-27-9-11)15-6-10(8-25(15)19(24)28)17-13(21)3-2-12(20)18(17)22/h2-3,10-11H,4-9H2,1H3,(H,23,26)/t10-,11+/m1/s1 |
| InChIKey | ACBDUHKODZHRBY-MNOVXSKESA-N |
| XLogP | 3.38 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|