C13H12BrFN2S — CID 134373460
(6S)-6-(5-bromo-2-fluorophenyl)-1-methyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 134373460) has the molecular formula C13H12BrFN2S and a molecular weight of 327.22 g/mol. Its IUPAC name is (6S)-6-(5-bromo-2-fluorophenyl)-1-methyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6S)-6-(5-bromo-2-fluorophenyl)-1-methyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 134373460 |
| Molecular Formula | C13H12BrFN2S |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | (6S)-6-(5-bromo-2-fluorophenyl)-1-methyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Cc1[nH]c(=S)n2c1C[C@@H](c1cc(Br)ccc1F)C2 |
| InChI | InChI=1S/C13H12BrFN2S/c1-7-12-4-8(6-17(12)13(18)16-7)10-5-9(14)2-3-11(10)15/h2-3,5,8H,4,6H2,1H3,(H,16,18)/t8-/m1/s1 |
| InChIKey | FCZUKDYWDKZOJM-MRVPVSSYSA-N |
| XLogP | 4.10 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|