C11H13BrFNOS — CID 82973307
3-(5-bromo-2-fluorophenyl)-5-methyl-1,4-thiazinane 1-oxide (PubChem CID 82973307) has the molecular formula C11H13BrFNOS and a molecular weight of 306.20 g/mol. Its IUPAC name is 3-(5-bromo-2-fluorophenyl)-5-methyl-1,4-thiazinane 1-oxide.
| Compound Name | 3-(5-bromo-2-fluorophenyl)-5-methyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 82973307 |
| Molecular Formula | C11H13BrFNOS |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 3-(5-bromo-2-fluorophenyl)-5-methyl-1,4-thiazinane 1-oxide |
| SMILES | CC1CS(=O)CC(c2cc(Br)ccc2F)N1 |
| InChI | InChI=1S/C11H13BrFNOS/c1-7-5-16(15)6-11(14-7)9-4-8(12)2-3-10(9)13/h2-4,7,11,14H,5-6H2,1H3 |
| InChIKey | TUBFCCOUZVNFJD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |