C12H15BrFNOS — CID 82972936
3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1-oxide (PubChem CID 82972936) has the molecular formula C12H15BrFNOS and a molecular weight of 320.23 g/mol. Its IUPAC name is 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1-oxide.
| Compound Name | 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 82972936 |
| Molecular Formula | C12H15BrFNOS |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1-oxide |
| SMILES | CC1CCNC(c2cc(Br)ccc2F)CS1=O |
| InChI | InChI=1S/C12H15BrFNOS/c1-8-4-5-15-12(7-17(8)16)10-6-9(13)2-3-11(10)14/h2-3,6,8,12,15H,4-5,7H2,1H3 |
| InChIKey | NYWQYNKFLWCKCV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |