C11H11BrFNO3S — CID 82974005
5-(4-bromo-2-fluorophenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 82974005) has the molecular formula C11H11BrFNO3S and a molecular weight of 336.18 g/mol. Its IUPAC name is 5-(4-bromo-2-fluorophenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid.
| Compound Name | 5-(4-bromo-2-fluorophenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 82974005 |
| Molecular Formula | C11H11BrFNO3S |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 5-(4-bromo-2-fluorophenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)CC(c2ccc(Br)cc2F)N1 |
| InChI | InChI=1S/C11H11BrFNO3S/c12-6-1-2-7(8(13)3-6)9-4-18(17)5-10(14-9)11(15)16/h1-3,9-10,14H,4-5H2,(H,15,16) |
| InChIKey | LZQNPXPUITXXOD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |