C11H11Cl2NO3S — CID 65171119
5-(2,4-dichlorophenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 65171119) has the molecular formula C11H11Cl2NO3S and a molecular weight of 308.19 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid.
| Compound Name | 5-(2,4-dichlorophenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 65171119 |
| Molecular Formula | C11H11Cl2NO3S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)CC(c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C11H11Cl2NO3S/c12-6-1-2-7(8(13)3-6)9-4-18(17)5-10(14-9)11(15)16/h1-3,9-10,14H,4-5H2,(H,15,16) |
| InChIKey | GSOWTCNHBUWXKQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |