C12H15NO5S2 — CID 65170913
5-(4-methylsulfonylphenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 65170913) has the molecular formula C12H15NO5S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid.
| Compound Name | 5-(4-methylsulfonylphenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 65170913 |
| Molecular Formula | C12H15NO5S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-1-oxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(C2CS(=O)CC(C(=O)O)N2)cc1 |
| InChI | InChI=1S/C12H15NO5S2/c1-20(17,18)9-4-2-8(3-5-9)10-6-19(16)7-11(13-10)12(14)15/h2-5,10-11,13H,6-7H2,1H3,(H,14,15) |
| InChIKey | VPNBFELEYBXVMB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |