About 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid
5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid (PubChem CID 101074729) has the molecular formula C18H17Cl2NO3
and a molecular weight of 366.24 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 101074729 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C2CC(c3ccc(Cl)cc3Cl)NC2C(=O)O)cc1 |
| InChI | InChI=1S/C18H17Cl2NO3/c1-24-12-5-2-10(3-6-12)14-9-16(21-17(14)18(22)23)13-7-4-11(19)8-15(13)20/h2-8,14,16-17,21H,9H2,1H3,(H,22,23) |
| InChIKey | KWGSBSYJRWGHBE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid (CID 101074729) is 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid is COc1ccc(C2CC(c3ccc(Cl)cc3Cl)NC2C(=O)O)cc1.
What is the InChIKey of 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid?
The InChIKey is KWGSBSYJRWGHBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NO3/c1-24-12-5-2-10(3-6-12)14-9-16(21-17(14)18(22)23)13-7-4-11(19)8-15(13)20/h2-8,14,16-17,21H,9H2,1H3,(H,22,23).
What are the key properties of 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid?
5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid has a molecular weight of 366.24 g/mol, XLogP of 4.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 101074729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).