C10H11BrFN — CID 94556792
[(1R,2R)-2-(5-bromo-2-fluorophenyl)cyclopropyl]methanamine (PubChem CID 94556792) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is [(1R,2R)-2-(5-bromo-2-fluorophenyl)cyclopropyl]methanamine.
| Compound Name | [(1R,2R)-2-(5-bromo-2-fluorophenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 94556792 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | [(1R,2R)-2-(5-bromo-2-fluorophenyl)cyclopropyl]methanamine |
| SMILES | NC[C@@H]1C[C@H]1c1cc(Br)ccc1F |
| InChI | InChI=1S/C10H11BrFN/c11-7-1-2-10(12)9(4-7)8-3-6(8)5-13/h1-2,4,6,8H,3,5,13H2/t6-,8+/m0/s1 |
| InChIKey | DZYHUVOZGVDCPW-POYBYMJQSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |