C10H11BrFN — CID 81014478
2-(5-bromo-2-fluorophenyl)cyclobutan-1-amine (PubChem CID 81014478) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)cyclobutan-1-amine.
| Compound Name | 2-(5-bromo-2-fluorophenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 81014478 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)cyclobutan-1-amine |
| SMILES | NC1CCC1c1cc(Br)ccc1F |
| InChI | InChI=1S/C10H11BrFN/c11-6-1-3-9(12)8(5-6)7-2-4-10(7)13/h1,3,5,7,10H,2,4,13H2 |
| InChIKey | JBDXSLNHWCKNLA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |