C23H18N2O5 — CID 138683165
methanol;2-[1-(3-oxo-1H-2-benzofuran-1-yl)benzimidazol-2-yl]benzoic acid (PubChem CID 138683165) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is methanol;2-[1-(3-oxo-1H-2-benzofuran-1-yl)benzimidazol-2-yl]benzoic acid.
| Compound Name | methanol;2-[1-(3-oxo-1H-2-benzofuran-1-yl)benzimidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 138683165 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | methanol;2-[1-(3-oxo-1H-2-benzofuran-1-yl)benzimidazol-2-yl]benzoic acid |
| SMILES | CO.O=C(O)c1ccccc1-c1nc2ccccc2n1C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H14N2O4.CH4O/c25-21(26)15-9-3-1-7-13(15)19-23-17-11-5-6-12-18(17)24(19)20-14-8-2-4-10-16(14)22(27)28-20;1-2/h1-12,20H,(H,25,26);2H,1H3 |
| InChIKey | UGUGMOBPLYBKIM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |