C28H19N5O2 — CID 58776955
2-[3-(4-anilinophenyl)iminopyrazolo[1,5-a]benzimidazol-2-yl]benzoic acid (PubChem CID 58776955) has the molecular formula C28H19N5O2 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-[3-(4-anilinophenyl)iminopyrazolo[1,5-a]benzimidazol-2-yl]benzoic acid.
| Compound Name | 2-[3-(4-anilinophenyl)iminopyrazolo[1,5-a]benzimidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 58776955 |
| Molecular Formula | C28H19N5O2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-[3-(4-anilinophenyl)iminopyrazolo[1,5-a]benzimidazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C1=Nn2c(nc3ccccc32)/C1=N\c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C28H19N5O2/c34-28(35)22-11-5-4-10-21(22)25-26(27-31-23-12-6-7-13-24(23)33(27)32-25)30-20-16-14-19(15-17-20)29-18-8-2-1-3-9-18/h1-17,29H,(H,34,35)/b30-26- |
| InChIKey | MBEWNSBUDVRCDC-BXVZCJGGSA-N |
| XLogP | 5.86 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|