C18H11ClN4O — CID 138683242
2-chloro-5-cyano-N-(6-pyridin-2-yl-3-pyridinyl)benzamide (PubChem CID 138683242) has the molecular formula C18H11ClN4O and a molecular weight of 334.77 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-(6-pyridin-2-yl-3-pyridinyl)benzamide.
| Compound Name | 2-chloro-5-cyano-N-(6-pyridin-2-yl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 138683242 |
| Molecular Formula | C18H11ClN4O |
| Molecular Weight | 334.77 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-chloro-5-cyano-N-(6-pyridin-2-yl-3-pyridinyl)benzamide |
| SMILES | N#Cc1ccc(Cl)c(C(=O)Nc2ccc(-c3ccccn3)nc2)c1 |
| InChI | InChI=1S/C18H11ClN4O/c19-15-6-4-12(10-20)9-14(15)18(24)23-13-5-7-17(22-11-13)16-3-1-2-8-21-16/h1-9,11H,(H,23,24) |
| InChIKey | HSWJQQXVPVALPE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |