C22H30ClF5N3O6S- — CID 138684112
[(3R,5S)-5-[[(3S,4R)-5,5-difluoro-4-hydroxy-2-methyl-6-oxo-6-(2,2,2-trifluoroethylamino)hexan-3-yl]carbamoyl]pyrrolidin-3-yl]-(4-methoxyphenyl)methanesulfinate;hydrochloride (PubChem CID 138684112) has the molecular formula C22H30ClF5N3O6S- and a molecular weight of 595.01 g/mol. Its IUPAC name is [(3R,5S)-5-[[(3S,4R)-5,5-difluoro-4-hydroxy-2-methyl-6-oxo-6-(2,2,2-trifluoroethylamino)hexan-3-yl]carbamoyl]pyrrolidin-3-yl]-(4-methoxyphenyl)methanesulfinate;hydrochloride.
| Compound Name | [(3R,5S)-5-[[(3S,4R)-5,5-difluoro-4-hydroxy-2-methyl-6-oxo-6-(2,2,2-trifluoroethylamino)hexan-3-yl]carbamoyl]pyrrolidin-3-yl]-(4-methoxyphenyl)methanesulfinate;hydrochloride |
|---|---|
| PubChem CID | 138684112 |
| Molecular Formula | C22H30ClF5N3O6S- |
| Molecular Weight | 595.01 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | [(3R,5S)-5-[[(3S,4R)-5,5-difluoro-4-hydroxy-2-methyl-6-oxo-6-(2,2,2-trifluoroethylamino)hexan-3-yl]carbamoyl]pyrrolidin-3-yl]-(4-methoxyphenyl)methanesulfinate;hydrochloride |
| SMILES | COc1ccc(C([C@H]2CN[C@H](C(=O)N[C@@H](C(C)C)[C@@H](O)C(F)(F)C(=O)NCC(F)(F)F)C2)S(=O)[O-])cc1.Cl |
| InChI | InChI=1S/C22H30F5N3O6S.ClH/c1-11(2)16(18(31)22(26,27)20(33)29-10-21(23,24)25)30-19(32)15-8-13(9-28-15)17(37(34)35)12-4-6-14(36-3)7-5-12;/h4-7,11,13,15-18,28,31H,8-10H2,1-3H3,(H,29,33)(H,30,32)(H,34,35);1H/p-1/t13-,15+,16+,17?,18-;/m1./s1 |
| InChIKey | DPKZPAQKKUXUGM-XTYZFBIVSA-M |
| XLogP | 1.83 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.01 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|