C19H24F5N3O4 — CID 137365085
(3R,4S)-4-[[(2S)-2-amino-2-(4-methoxyphenyl)acetyl]amino]-4-cyclobutyl-2,2-difluoro-3-hydroxy-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 137365085) has the molecular formula C19H24F5N3O4 and a molecular weight of 453.41 g/mol. Its IUPAC name is (3R,4S)-4-[[(2S)-2-amino-2-(4-methoxyphenyl)acetyl]amino]-4-cyclobutyl-2,2-difluoro-3-hydroxy-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (3R,4S)-4-[[(2S)-2-amino-2-(4-methoxyphenyl)acetyl]amino]-4-cyclobutyl-2,2-difluoro-3-hydroxy-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 137365085 |
| Molecular Formula | C19H24F5N3O4 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (3R,4S)-4-[[(2S)-2-amino-2-(4-methoxyphenyl)acetyl]amino]-4-cyclobutyl-2,2-difluoro-3-hydroxy-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | COc1ccc([C@H](N)C(=O)N[C@@H](C2CCC2)[C@@H](O)C(F)(F)C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H24F5N3O4/c1-31-12-7-5-10(6-8-12)13(25)16(29)27-14(11-3-2-4-11)15(28)19(23,24)17(30)26-9-18(20,21)22/h5-8,11,13-15,28H,2-4,9,25H2,1H3,(H,26,30)(H,27,29)/t13-,14-,15+/m0/s1 |
| InChIKey | CDMUWHKSVSDFAH-SOUVJXGZSA-N |
| XLogP | 1.65 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |