C36H51NO8 — CID 138685220
[(2R,3S,4R,5R)-6-benzyl-5-(butanoylamino)-3-hexanoyl-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl hexanoate (PubChem CID 138685220) has the molecular formula C36H51NO8 and a molecular weight of 625.80 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-6-benzyl-5-(butanoylamino)-3-hexanoyl-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl hexanoate.
| Compound Name | [(2R,3S,4R,5R)-6-benzyl-5-(butanoylamino)-3-hexanoyl-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 138685220 |
| Molecular Formula | C36H51NO8 |
| Molecular Weight | 625.80 g/mol |
| Exact Mass | 625.36 |
| IUPAC Name | [(2R,3S,4R,5R)-6-benzyl-5-(butanoylamino)-3-hexanoyl-3,6-dihydroxy-4-phenylmethoxyoxan-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OC[C@H]1OC(O)(Cc2ccccc2)C(NC(=O)CCC)[C@@H](OCc2ccccc2)[C@@]1(O)C(=O)CCCCC |
| InChI | InChI=1S/C36H51NO8/c1-4-7-11-22-29(38)36(42)30(26-43-32(40)23-12-8-5-2)45-35(41,24-27-18-13-9-14-19-27)33(37-31(39)17-6-3)34(36)44-25-28-20-15-10-16-21-28/h9-10,13-16,18-21,30,33-34,41-42H,4-8,11-12,17,22-26H2,1-3H3,(H,37,39)/t30-,33?,34-,35?,36-/m1/s1 |
| InChIKey | NZBGTLJWOAGGCK-XSYZAIKHSA-N |
| XLogP | 5.19 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.80 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|