C26H35N7O2S — CID 138686550
2-[[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]amino]ethanesulfonamide (PubChem CID 138686550) has the molecular formula C26H35N7O2S and a molecular weight of 509.68 g/mol. Its IUPAC name is 2-[[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]amino]ethanesulfonamide.
| Compound Name | 2-[[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 138686550 |
| Molecular Formula | C26H35N7O2S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | 2-[[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]amino]ethanesulfonamide |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCC(NCCS(N)(=O)=O)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C26H35N7O2S/c1-15(2)23-24(20-13-33-26(29-14-30-33)17(4)16(20)3)32-22-10-9-21(31-25(22)23)18-5-7-19(8-6-18)28-11-12-36(27,34)35/h9-10,13-15,18-19,28,32H,5-8,11-12H2,1-4H3,(H2,27,34,35) |
| InChIKey | PINRFUQOFUNEEZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |