C27H33N7 — CID 138686610
3-[[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]amino]propanenitrile (PubChem CID 138686610) has the molecular formula C27H33N7 and a molecular weight of 455.61 g/mol. Its IUPAC name is 3-[[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]amino]propanenitrile.
| Compound Name | 3-[[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]amino]propanenitrile |
|---|---|
| PubChem CID | 138686610 |
| Molecular Formula | C27H33N7 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 3-[[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]amino]propanenitrile |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCC(NCCC#N)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C27H33N7/c1-16(2)24-25(21-14-34-27(30-15-31-34)18(4)17(21)3)33-23-11-10-22(32-26(23)24)19-6-8-20(9-7-19)29-13-5-12-28/h10-11,14-16,19-20,29,33H,5-9,13H2,1-4H3 |
| InChIKey | DURXHEVPESYLEY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|