C28H36N6S — CID 155226031
N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]thiolan-3-amine (PubChem CID 155226031) has the molecular formula C28H36N6S and a molecular weight of 488.71 g/mol. Its IUPAC name is N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]thiolan-3-amine.
| Compound Name | N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]thiolan-3-amine |
|---|---|
| PubChem CID | 155226031 |
| Molecular Formula | C28H36N6S |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]thiolan-3-amine |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCC(NC5CCSC5)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C28H36N6S/c1-16(2)25-26(22-13-34-28(29-15-30-34)18(4)17(22)3)33-24-10-9-23(32-27(24)25)19-5-7-20(8-6-19)31-21-11-12-35-14-21/h9-10,13,15-16,19-21,31,33H,5-8,11-12,14H2,1-4H3 |
| InChIKey | ITAAKYSPPJSDKY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |