C19H18F3N5O — CID 138687178
N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-5-amine (PubChem CID 138687178) has the molecular formula C19H18F3N5O and a molecular weight of 389.38 g/mol. Its IUPAC name is N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-5-amine.
| Compound Name | N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 138687178 |
| Molecular Formula | C19H18F3N5O |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-5-amine |
| SMILES | FC(F)(F)c1nc(-c2ccc(CNC3CCCNc4ccccc43)nc2)no1 |
| InChI | InChI=1S/C19H18F3N5O/c20-19(21,22)18-26-17(27-28-18)12-7-8-13(24-10-12)11-25-16-6-3-9-23-15-5-2-1-4-14(15)16/h1-2,4-5,7-8,10,16,23,25H,3,6,9,11H2 |
| InChIKey | ZDADRUQXAJNLEZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |