C26H22FN5O3S — CID 138689091
4-[6-amino-5-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)-3-pyridinyl]-N-(3-aminophenyl)-3-fluorobenzenesulfonamide (PubChem CID 138689091) has the molecular formula C26H22FN5O3S and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[6-amino-5-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)-3-pyridinyl]-N-(3-aminophenyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-[6-amino-5-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)-3-pyridinyl]-N-(3-aminophenyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 138689091 |
| Molecular Formula | C26H22FN5O3S |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 4-[6-amino-5-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)-3-pyridinyl]-N-(3-aminophenyl)-3-fluorobenzenesulfonamide |
| SMILES | Nc1cccc(NS(=O)(=O)c2ccc(-c3cnc(N)c(-c4ccc5c(c4)CCNC5=O)c3)c(F)c2)c1 |
| InChI | InChI=1S/C26H22FN5O3S/c27-24-13-20(36(34,35)32-19-3-1-2-18(28)12-19)5-7-21(24)17-11-23(25(29)31-14-17)15-4-6-22-16(10-15)8-9-30-26(22)33/h1-7,10-14,32H,8-9,28H2,(H2,29,31)(H,30,33) |
| InChIKey | GRKKCYGTJRMIJI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|