C30H42N8O4 — CID 138689448
2-amino-N-[(2S,5R)-8-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(4-hydroxy-2,6-dimethylphenyl)-3-oxooctan-2-yl]-4-(diaminomethylideneamino)butanamide (PubChem CID 138689448) has the molecular formula C30H42N8O4 and a molecular weight of 578.72 g/mol. Its IUPAC name is 2-amino-N-[(2S,5R)-8-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(4-hydroxy-2,6-dimethylphenyl)-3-oxooctan-2-yl]-4-(diaminomethylideneamino)butanamide.
| Compound Name | 2-amino-N-[(2S,5R)-8-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(4-hydroxy-2,6-dimethylphenyl)-3-oxooctan-2-yl]-4-(diaminomethylideneamino)butanamide |
|---|---|
| PubChem CID | 138689448 |
| Molecular Formula | C30H42N8O4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | 2-amino-N-[(2S,5R)-8-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(4-hydroxy-2,6-dimethylphenyl)-3-oxooctan-2-yl]-4-(diaminomethylideneamino)butanamide |
| SMILES | Cc1cc(O)cc(C)c1C[C@H](NC(=O)C(N)CCN=C(N)N)C(=O)C[C@@H](CCCN)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C30H42N8O4/c1-18-13-22(39)14-19(2)23(18)17-25(36-28(41)24(32)10-12-35-30(33)34)26(40)16-21(9-6-11-31)29-37-27(38-42-29)15-20-7-4-3-5-8-20/h3-5,7-8,13-14,21,24-25,39H,6,9-12,15-17,31-32H2,1-2H3,(H,36,41)(H4,33,34,35)/t21-,24?,25+/m1/s1 |
| InChIKey | XZFWIGZCSPIMON-PIHPCUNDSA-N |
| XLogP | 1.48 |
| TPSA | 221.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|