C31H44N8O4 — CID 175525675
2,6-diamino-N-[1-[[5-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]amino]-3-(4-hydroxy-2,6-dimethylphenyl)-1-oxopropan-2-yl]-6-iminohexanamide (PubChem CID 175525675) has the molecular formula C31H44N8O4 and a molecular weight of 592.75 g/mol. Its IUPAC name is 2,6-diamino-N-[1-[[5-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]amino]-3-(4-hydroxy-2,6-dimethylphenyl)-1-oxopropan-2-yl]-6-iminohexanamide.
| Compound Name | 2,6-diamino-N-[1-[[5-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]amino]-3-(4-hydroxy-2,6-dimethylphenyl)-1-oxopropan-2-yl]-6-iminohexanamide |
|---|---|
| PubChem CID | 175525675 |
| Molecular Formula | C31H44N8O4 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | 2,6-diamino-N-[1-[[5-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]amino]-3-(4-hydroxy-2,6-dimethylphenyl)-1-oxopropan-2-yl]-6-iminohexanamide |
| SMILES | [H]/N=C(\N)CCCC(N)C(=O)NC(Cc1c(C)cc(O)cc1C)C(=O)NC(CCCCN)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C31H44N8O4/c1-19-15-22(40)16-20(2)23(19)18-26(37-29(41)24(33)11-8-13-27(34)35)30(42)36-25(12-6-7-14-32)31-38-28(39-43-31)17-21-9-4-3-5-10-21/h3-5,9-10,15-16,24-26,40H,6-8,11-14,17-18,32-33H2,1-2H3,(H3,34,35)(H,36,42)(H,37,41) |
| InChIKey | WNZWEYMCFQROLV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 219.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|