C14H28NPS2 — CID 138690117
N-propan-2-yl-10,12-dithia-11-phosphabicyclo[6.5.1]tetradecan-4-amine (PubChem CID 138690117) has the molecular formula C14H28NPS2 and a molecular weight of 305.49 g/mol. Its IUPAC name is N-propan-2-yl-10,12-dithia-11-phosphabicyclo[6.5.1]tetradecan-4-amine.
| Compound Name | N-propan-2-yl-10,12-dithia-11-phosphabicyclo[6.5.1]tetradecan-4-amine |
|---|---|
| PubChem CID | 138690117 |
| Molecular Formula | C14H28NPS2 |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-propan-2-yl-10,12-dithia-11-phosphabicyclo[6.5.1]tetradecan-4-amine |
| SMILES | CC(C)NC1CCCC2CSPSCC(CC1)C2 |
| InChI | InChI=1S/C14H28NPS2/c1-11(2)15-14-5-3-4-12-8-13(6-7-14)10-18-16-17-9-12/h11-16H,3-10H2,1-2H3 |
| InChIKey | SECUHMIOURBBBC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|