C12H16F3N3O3 — CID 138691851
N'-[4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutyl]-2,2,2-trifluoroacetohydrazide (PubChem CID 138691851) has the molecular formula C12H16F3N3O3 and a molecular weight of 307.27 g/mol. Its IUPAC name is N'-[4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutyl]-2,2,2-trifluoroacetohydrazide.
| Compound Name | N'-[4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutyl]-2,2,2-trifluoroacetohydrazide |
|---|---|
| PubChem CID | 138691851 |
| Molecular Formula | C12H16F3N3O3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N'-[4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutyl]-2,2,2-trifluoroacetohydrazide |
| SMILES | CC(C)(CCN1C(=O)C=CC1=O)CNNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O3/c1-11(2,7-16-17-10(21)12(13,14)15)5-6-18-8(19)3-4-9(18)20/h3-4,16H,5-7H2,1-2H3,(H,17,21) |
| InChIKey | QGPPEGZOPWBJKK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|