C10H15N3O3 — CID 70980511
4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutanehydrazide (PubChem CID 70980511) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutanehydrazide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 70980511 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutanehydrazide |
| SMILES | CC(C)(CCN1C(=O)C=CC1=O)C(=O)NN |
| InChI | InChI=1S/C10H15N3O3/c1-10(2,9(16)12-11)5-6-13-7(14)3-4-8(13)15/h3-4H,5-6,11H2,1-2H3,(H,12,16) |
| InChIKey | ZIFCUDMOQKOJCS-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|