C8H12ClN3O3 — CID 71748351
4-(2,5-dioxopyrrol-1-yl)butanehydrazide;hydrochloride (PubChem CID 71748351) has the molecular formula C8H12ClN3O3 and a molecular weight of 233.65 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanehydrazide;hydrochloride.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanehydrazide;hydrochloride |
|---|---|
| PubChem CID | 71748351 |
| Molecular Formula | C8H12ClN3O3 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanehydrazide;hydrochloride |
| SMILES | Cl.NNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H11N3O3.ClH/c9-10-6(12)2-1-5-11-7(13)3-4-8(11)14;/h3-4H,1-2,5,9H2,(H,10,12);1H |
| InChIKey | GFZJTCCUUNLIGG-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|