C11H15N3O5 — CID 141356544
[[4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutanoyl]amino]carbamic acid (PubChem CID 141356544) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is [[4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutanoyl]amino]carbamic acid.
| Compound Name | [[4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutanoyl]amino]carbamic acid |
|---|---|
| PubChem CID | 141356544 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [[4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylbutanoyl]amino]carbamic acid |
| SMILES | CC(C)(CCN1C(=O)C=CC1=O)C(=O)NNC(=O)O |
| InChI | InChI=1S/C11H15N3O5/c1-11(2,9(17)12-13-10(18)19)5-6-14-7(15)3-4-8(14)16/h3-4,13H,5-6H2,1-2H3,(H,12,17)(H,18,19) |
| InChIKey | WNXNWKGPYOZGSO-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|