C12H23NO6S — CID 138696976
[(3S,6R)-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]oxan-3-yl] methanesulfonate (PubChem CID 138696976) has the molecular formula C12H23NO6S and a molecular weight of 309.38 g/mol. Its IUPAC name is [(3S,6R)-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]oxan-3-yl] methanesulfonate.
| Compound Name | [(3S,6R)-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]oxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 138696976 |
| Molecular Formula | C12H23NO6S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [(3S,6R)-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]oxan-3-yl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CC[C@H](OS(C)(=O)=O)CO1 |
| InChI | InChI=1S/C12H23NO6S/c1-12(2,3)18-11(14)13-7-9-5-6-10(8-17-9)19-20(4,15)16/h9-10H,5-8H2,1-4H3,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | FFVUWDYEJNDUJP-ZJUUUORDSA-N |
| XLogP | 1.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|