C13H23NO4 — CID 165468135
tert-butyl N-[[(2S,4S)-4-propanoyloxolan-2-yl]methyl]carbamate (PubChem CID 165468135) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl N-[[(2S,4S)-4-propanoyloxolan-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2S,4S)-4-propanoyloxolan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 165468135 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | tert-butyl N-[[(2S,4S)-4-propanoyloxolan-2-yl]methyl]carbamate |
| SMILES | CCC(=O)[C@@H]1CO[C@H](CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H23NO4/c1-5-11(15)9-6-10(17-8-9)7-14-12(16)18-13(2,3)4/h9-10H,5-8H2,1-4H3,(H,14,16)/t9-,10-/m0/s1 |
| InChIKey | HWYZFFGEHUKYMT-UWVGGRQHSA-N |
| XLogP | 1.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |