C29H30FN3O5S — CID 138697459
2-butyl-5-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1R)-2-methoxy-1-phenylethyl]pyrimidin-4-one (PubChem CID 138697459) has the molecular formula C29H30FN3O5S and a molecular weight of 551.64 g/mol. Its IUPAC name is 2-butyl-5-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1R)-2-methoxy-1-phenylethyl]pyrimidin-4-one.
| Compound Name | 2-butyl-5-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1R)-2-methoxy-1-phenylethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 138697459 |
| Molecular Formula | C29H30FN3O5S |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 2-butyl-5-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1R)-2-methoxy-1-phenylethyl]pyrimidin-4-one |
| SMILES | CCCCc1nc(O)c(S(=O)(=O)c2ccc(-c3ccc(F)nc3C)cc2)c(=O)n1[C@@H](COC)c1ccccc1 |
| InChI | InChI=1S/C29H30FN3O5S/c1-4-5-11-26-32-28(34)27(29(35)33(26)24(18-38-3)21-9-7-6-8-10-21)39(36,37)22-14-12-20(13-15-22)23-16-17-25(30)31-19(23)2/h6-10,12-17,24,34H,4-5,11,18H2,1-3H3/t24-/m0/s1 |
| InChIKey | RUWOJSXBTFAZKV-DEOSSOPVSA-N |
| XLogP | 4.87 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|