C27H26FN3O4S — CID 138697553
2-butyl-5-[4-(6-fluoro-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1R)-1-phenylethyl]pyrimidin-4-one (PubChem CID 138697553) has the molecular formula C27H26FN3O4S and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-butyl-5-[4-(6-fluoro-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1R)-1-phenylethyl]pyrimidin-4-one.
| Compound Name | 2-butyl-5-[4-(6-fluoro-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1R)-1-phenylethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 138697553 |
| Molecular Formula | C27H26FN3O4S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2-butyl-5-[4-(6-fluoro-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1R)-1-phenylethyl]pyrimidin-4-one |
| SMILES | CCCCc1nc(O)c(S(=O)(=O)c2ccc(-c3ccc(F)nc3)cc2)c(=O)n1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H26FN3O4S/c1-3-4-10-24-30-26(32)25(27(33)31(24)18(2)19-8-6-5-7-9-19)36(34,35)22-14-11-20(12-15-22)21-13-16-23(28)29-17-21/h5-9,11-18,32H,3-4,10H2,1-2H3/t18-/m1/s1 |
| InChIKey | JBPGSQYVKYQABN-GOSISDBHSA-N |
| XLogP | 4.93 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|