C27H26FN3O5S — CID 138697884
2-(ethoxymethyl)-5-[4-(6-fluoro-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-(1-phenylpropyl)pyrimidin-4-one (PubChem CID 138697884) has the molecular formula C27H26FN3O5S and a molecular weight of 523.59 g/mol. Its IUPAC name is 2-(ethoxymethyl)-5-[4-(6-fluoro-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-(1-phenylpropyl)pyrimidin-4-one.
| Compound Name | 2-(ethoxymethyl)-5-[4-(6-fluoro-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-(1-phenylpropyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 138697884 |
| Molecular Formula | C27H26FN3O5S |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-(ethoxymethyl)-5-[4-(6-fluoro-3-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-(1-phenylpropyl)pyrimidin-4-one |
| SMILES | CCOCc1nc(O)c(S(=O)(=O)c2ccc(-c3ccc(F)nc3)cc2)c(=O)n1C(CC)c1ccccc1 |
| InChI | InChI=1S/C27H26FN3O5S/c1-3-22(19-8-6-5-7-9-19)31-24(17-36-4-2)30-26(32)25(27(31)33)37(34,35)21-13-10-18(11-14-21)20-12-15-23(28)29-16-20/h5-16,22,32H,3-4,17H2,1-2H3 |
| InChIKey | JYLQWRPHDAFUOB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|