C28H34FN3O5S — CID 138697834
2-butyl-5-[4-(2-fluoro-3-methyl-4-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1S)-1-(oxan-4-yl)propyl]pyrimidin-4-one (PubChem CID 138697834) has the molecular formula C28H34FN3O5S and a molecular weight of 543.66 g/mol. Its IUPAC name is 2-butyl-5-[4-(2-fluoro-3-methyl-4-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1S)-1-(oxan-4-yl)propyl]pyrimidin-4-one.
| Compound Name | 2-butyl-5-[4-(2-fluoro-3-methyl-4-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1S)-1-(oxan-4-yl)propyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 138697834 |
| Molecular Formula | C28H34FN3O5S |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-butyl-5-[4-(2-fluoro-3-methyl-4-pyridinyl)phenyl]sulfonyl-6-hydroxy-3-[(1S)-1-(oxan-4-yl)propyl]pyrimidin-4-one |
| SMILES | CCCCc1nc(O)c(S(=O)(=O)c2ccc(-c3ccnc(F)c3C)cc2)c(=O)n1[C@@H](CC)C1CCOCC1 |
| InChI | InChI=1S/C28H34FN3O5S/c1-4-6-7-24-31-27(33)25(28(34)32(24)23(5-2)20-13-16-37-17-14-20)38(35,36)21-10-8-19(9-11-21)22-12-15-30-26(29)18(22)3/h8-12,15,20,23,33H,4-7,13-14,16-17H2,1-3H3/t23-/m0/s1 |
| InChIKey | UDBZSHKPCAWYNA-QHCPKHFHSA-N |
| XLogP | 5.01 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|