C28H33FN4O12P2 — CID 138699119
5-amino-1-cyclopropyl-7-[4-[4-(2,2-diphosphonoethyl)phenoxy]carbonyl-3-methylpiperazin-1-yl]-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 138699119) has the molecular formula C28H33FN4O12P2 and a molecular weight of 698.53 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-7-[4-[4-(2,2-diphosphonoethyl)phenoxy]carbonyl-3-methylpiperazin-1-yl]-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-1-cyclopropyl-7-[4-[4-(2,2-diphosphonoethyl)phenoxy]carbonyl-3-methylpiperazin-1-yl]-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 138699119 |
| Molecular Formula | C28H33FN4O12P2 |
| Molecular Weight | 698.53 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | 5-amino-1-cyclopropyl-7-[4-[4-(2,2-diphosphonoethyl)phenoxy]carbonyl-3-methylpiperazin-1-yl]-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCN(C(=O)Oc3ccc(CC(P(=O)(O)O)P(=O)(O)O)cc3)C(C)C2)c(F)c(N)c2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C28H33FN4O12P2/c1-14-12-31(9-10-32(14)28(37)45-17-7-3-15(4-8-17)11-19(46(38,39)40)47(41,42)43)24-21(29)22(30)20-23(26(24)44-2)33(16-5-6-16)13-18(25(20)34)27(35)36/h3-4,7-8,13-14,16,19H,5-6,9-12,30H2,1-2H3,(H,35,36)(H2,38,39,40)(H2,41,42,43) |
| InChIKey | OUTUWJZJJUWYAJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 242.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|