C27H30FN3O10 — CID 59845476
1-cyclopropyl-6-fluoro-7-[4-[(4-formyl-5-oxopentanoyl)oxymethoxycarbonyl]-3-methylpiperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 59845476) has the molecular formula C27H30FN3O10 and a molecular weight of 575.55 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[4-[(4-formyl-5-oxopentanoyl)oxymethoxycarbonyl]-3-methylpiperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[4-[(4-formyl-5-oxopentanoyl)oxymethoxycarbonyl]-3-methylpiperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 59845476 |
| Molecular Formula | C27H30FN3O10 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[4-[(4-formyl-5-oxopentanoyl)oxymethoxycarbonyl]-3-methylpiperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCN(C(=O)OCOC(=O)CCC(C=O)C=O)C(C)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C27H30FN3O10/c1-15-10-29(7-8-30(15)27(38)41-14-40-21(34)6-3-16(12-32)13-33)23-20(28)9-18-22(25(23)39-2)31(17-4-5-17)11-19(24(18)35)26(36)37/h9,11-13,15-17H,3-8,10,14H2,1-2H3,(H,36,37) |
| InChIKey | YKRQZQLIAMAJRA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 161.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|