C32H30OS — CID 138700384
1-tert-butyl-7-(4-tert-butyldibenzothiophen-2-yl)dibenzofuran (PubChem CID 138700384) has the molecular formula C32H30OS and a molecular weight of 462.66 g/mol. Its IUPAC name is 1-tert-butyl-7-(4-tert-butyldibenzothiophen-2-yl)dibenzofuran.
| Compound Name | 1-tert-butyl-7-(4-tert-butyldibenzothiophen-2-yl)dibenzofuran |
|---|---|
| PubChem CID | 138700384 |
| Molecular Formula | C32H30OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1-tert-butyl-7-(4-tert-butyldibenzothiophen-2-yl)dibenzofuran |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(c2)oc2cccc(C(C)(C)C)c23)cc2c1sc1ccccc12 |
| InChI | InChI=1S/C32H30OS/c1-31(2,3)24-11-9-12-26-29(24)22-15-14-19(18-27(22)33-26)20-16-23-21-10-7-8-13-28(21)34-30(23)25(17-20)32(4,5)6/h7-18H,1-6H3 |
| InChIKey | PPSYTNHACPDKQZ-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |