C19H17FN4OS2 — CID 138701156
2-[2-(cyclopropylsulfanylamino)-1,3-thiazol-4-yl]-N-(2-fluoro-4-pyridin-3-ylphenyl)acetamide (PubChem CID 138701156) has the molecular formula C19H17FN4OS2 and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfanylamino)-1,3-thiazol-4-yl]-N-(2-fluoro-4-pyridin-3-ylphenyl)acetamide.
| Compound Name | 2-[2-(cyclopropylsulfanylamino)-1,3-thiazol-4-yl]-N-(2-fluoro-4-pyridin-3-ylphenyl)acetamide |
|---|---|
| PubChem CID | 138701156 |
| Molecular Formula | C19H17FN4OS2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-[2-(cyclopropylsulfanylamino)-1,3-thiazol-4-yl]-N-(2-fluoro-4-pyridin-3-ylphenyl)acetamide |
| SMILES | O=C(Cc1csc(NSC2CC2)n1)Nc1ccc(-c2cccnc2)cc1F |
| InChI | InChI=1S/C19H17FN4OS2/c20-16-8-12(13-2-1-7-21-10-13)3-6-17(16)23-18(25)9-14-11-26-19(22-14)24-27-15-4-5-15/h1-3,6-8,10-11,15H,4-5,9H2,(H,22,24)(H,23,25) |
| InChIKey | AAKRHEQFXFZUJR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|