C26H30N6O2 — CID 138702138
N-methyl-N-(1-methylpiperidin-4-yl)-4-[[(E)-N'-(3-phenoxy-2-pyridinyl)carbamimidoyl]amino]benzamide (PubChem CID 138702138) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is N-methyl-N-(1-methylpiperidin-4-yl)-4-[[(E)-N'-(3-phenoxy-2-pyridinyl)carbamimidoyl]amino]benzamide.
| Compound Name | N-methyl-N-(1-methylpiperidin-4-yl)-4-[[(E)-N'-(3-phenoxy-2-pyridinyl)carbamimidoyl]amino]benzamide |
|---|---|
| PubChem CID | 138702138 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N-methyl-N-(1-methylpiperidin-4-yl)-4-[[(E)-N'-(3-phenoxy-2-pyridinyl)carbamimidoyl]amino]benzamide |
| SMILES | CN1CCC(N(C)C(=O)c2ccc(N/C(N)=N/c3ncccc3Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H30N6O2/c1-31-17-14-21(15-18-31)32(2)25(33)19-10-12-20(13-11-19)29-26(27)30-24-23(9-6-16-28-24)34-22-7-4-3-5-8-22/h3-13,16,21H,14-15,17-18H2,1-2H3,(H3,27,28,29,30) |
| InChIKey | CYEWESSUWJHCBT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|