C27H32N6O2 — CID 123448525
N-methyl-N-(1-methylpiperidin-4-yl)-4-[[N'-(3-phenylmethoxy-2-pyridinyl)carbamimidoyl]amino]benzamide (PubChem CID 123448525) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-methyl-N-(1-methylpiperidin-4-yl)-4-[[N'-(3-phenylmethoxy-2-pyridinyl)carbamimidoyl]amino]benzamide.
| Compound Name | N-methyl-N-(1-methylpiperidin-4-yl)-4-[[N'-(3-phenylmethoxy-2-pyridinyl)carbamimidoyl]amino]benzamide |
|---|---|
| PubChem CID | 123448525 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-methyl-N-(1-methylpiperidin-4-yl)-4-[[N'-(3-phenylmethoxy-2-pyridinyl)carbamimidoyl]amino]benzamide |
| SMILES | CN1CCC(N(C)C(=O)c2ccc(NC(N)=Nc3ncccc3OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H32N6O2/c1-32-17-14-23(15-18-32)33(2)26(34)21-10-12-22(13-11-21)30-27(28)31-25-24(9-6-16-29-25)35-19-20-7-4-3-5-8-20/h3-13,16,23H,14-15,17-19H2,1-2H3,(H3,28,29,30,31) |
| InChIKey | JHFRIGISTGEIEA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|