C20H17N5O — CID 54462075
1-(4-cyanophenyl)-2-(3-phenylmethoxy-2-pyridinyl)guanidine (PubChem CID 54462075) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-2-(3-phenylmethoxy-2-pyridinyl)guanidine.
| Compound Name | 1-(4-cyanophenyl)-2-(3-phenylmethoxy-2-pyridinyl)guanidine |
|---|---|
| PubChem CID | 54462075 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(4-cyanophenyl)-2-(3-phenylmethoxy-2-pyridinyl)guanidine |
| SMILES | N#Cc1ccc(NC(N)=Nc2ncccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H17N5O/c21-13-15-8-10-17(11-9-15)24-20(22)25-19-18(7-4-12-23-19)26-14-16-5-2-1-3-6-16/h1-12H,14H2,(H3,22,23,24,25) |
| InChIKey | XCHMPWBHMACLHD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|